C19H17ClF3N3O5S — CID 57235019
[4-[C-(4-chlorophenyl)-N-[[methyl(prop-2-enoxy)carbamoyl]amino]carbonimidoyl]phenyl] trifluoromethanesulfonate (PubChem CID 57235019) has the molecular formula C19H17ClF3N3O5S and a molecular weight of 491.88 g/mol. Its IUPAC name is [4-[C-(4-chlorophenyl)-N-[[methyl(prop-2-enoxy)carbamoyl]amino]carbonimidoyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[C-(4-chlorophenyl)-N-[[methyl(prop-2-enoxy)carbamoyl]amino]carbonimidoyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 57235019 |
| Molecular Formula | C19H17ClF3N3O5S |
| Molecular Weight | 491.88 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | [4-[C-(4-chlorophenyl)-N-[[methyl(prop-2-enoxy)carbamoyl]amino]carbonimidoyl]phenyl] trifluoromethanesulfonate |
| SMILES | C=CCON(C)C(=O)NN=C(c1ccc(Cl)cc1)c1ccc(OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H17ClF3N3O5S/c1-3-12-30-26(2)18(27)25-24-17(13-4-8-15(20)9-5-13)14-6-10-16(11-7-14)31-32(28,29)19(21,22)23/h3-11H,1,12H2,2H3,(H,25,27) |
| InChIKey | OHJCNBDNSSQFQD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.88 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|