About [4-[1,2-bis(4-chlorophenyl)-2-oxoethyl]phenyl] trifluoromethanesulfonate
[4-[1,2-bis(4-chlorophenyl)-2-oxoethyl]phenyl] trifluoromethanesulfonate (PubChem CID 11363822) has the molecular formula C21H13Cl2F3O4S
and a molecular weight of 489.30 g/mol. Its IUPAC name is [4-[1,2-bis(4-chlorophenyl)-2-oxoethyl]phenyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [4-[1,2-bis(4-chlorophenyl)-2-oxoethyl]phenyl] trifluoromethanesulfonate |
| PubChem CID | 11363822 |
| Molecular Formula | C21H13Cl2F3O4S |
| Molecular Weight | 489.30 g/mol |
| Exact Mass | 487.99 |
| IUPAC Name | [4-[1,2-bis(4-chlorophenyl)-2-oxoethyl]phenyl] trifluoromethanesulfonate |
| SMILES | O=C(c1ccc(Cl)cc1)C(c1ccc(Cl)cc1)c1ccc(OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H13Cl2F3O4S/c22-16-7-1-13(2-8-16)19(20(27)15-3-9-17(23)10-4-15)14-5-11-18(12-6-14)30-31(28,29)21(24,25)26/h1-12,19H |
| InChIKey | CJCSSIODGXZWLL-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.30 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [4-[1,2-bis(4-chlorophenyl)-2-oxoethyl]phenyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[1,2-bis(4-chlorophenyl)-2-oxoethyl]phenyl] trifluoromethanesulfonate?
The IUPAC name of [4-[1,2-bis(4-chlorophenyl)-2-oxoethyl]phenyl] trifluoromethanesulfonate (CID 11363822) is [4-[1,2-bis(4-chlorophenyl)-2-oxoethyl]phenyl] trifluoromethanesulfonate.
What is the SMILES notation for [4-[1,2-bis(4-chlorophenyl)-2-oxoethyl]phenyl] trifluoromethanesulfonate?
The canonical SMILES for [4-[1,2-bis(4-chlorophenyl)-2-oxoethyl]phenyl] trifluoromethanesulfonate is O=C(c1ccc(Cl)cc1)C(c1ccc(Cl)cc1)c1ccc(OS(=O)(=O)C(F)(F)F)cc1.
What is the InChIKey of [4-[1,2-bis(4-chlorophenyl)-2-oxoethyl]phenyl] trifluoromethanesulfonate?
The InChIKey is CJCSSIODGXZWLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H13Cl2F3O4S/c22-16-7-1-13(2-8-16)19(20(27)15-3-9-17(23)10-4-15)14-5-11-18(12-6-14)30-31(28,29)21(24,25)26/h1-12,19H.
What are the key properties of [4-[1,2-bis(4-chlorophenyl)-2-oxoethyl]phenyl] trifluoromethanesulfonate?
[4-[1,2-bis(4-chlorophenyl)-2-oxoethyl]phenyl] trifluoromethanesulfonate has a molecular weight of 489.30 g/mol, XLogP of 6.24, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[1,2-bis(4-chlorophenyl)-2-oxoethyl]phenyl] trifluoromethanesulfonate is sourced from PubChem (CID 11363822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).