C21H13Cl2F3O4S — CID 11363822
[4-[1,2-bis(4-chlorophenyl)-2-oxoethyl]phenyl] trifluoromethanesulfonate (PubChem CID 11363822) has the molecular formula C21H13Cl2F3O4S and a molecular weight of 489.30 g/mol. Its IUPAC name is [4-[1,2-bis(4-chlorophenyl)-2-oxoethyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[1,2-bis(4-chlorophenyl)-2-oxoethyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11363822 |
| Molecular Formula | C21H13Cl2F3O4S |
| Molecular Weight | 489.30 g/mol |
| Exact Mass | 487.99 |
| IUPAC Name | [4-[1,2-bis(4-chlorophenyl)-2-oxoethyl]phenyl] trifluoromethanesulfonate |
| SMILES | O=C(c1ccc(Cl)cc1)C(c1ccc(Cl)cc1)c1ccc(OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H13Cl2F3O4S/c22-16-7-1-13(2-8-16)19(20(27)15-3-9-17(23)10-4-15)14-5-11-18(12-6-14)30-31(28,29)21(24,25)26/h1-12,19H |
| InChIKey | CJCSSIODGXZWLL-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.30 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|