C20H18ClF3N2O6S — CID 139759334
butyl 2-[2-[(4-chlorophenyl)-[4-(trifluoromethylsulfonyloxy)phenyl]methylidene]hydrazinyl]-2-oxoacetate (PubChem CID 139759334) has the molecular formula C20H18ClF3N2O6S and a molecular weight of 506.89 g/mol. Its IUPAC name is butyl 2-[2-[(4-chlorophenyl)-[4-(trifluoromethylsulfonyloxy)phenyl]methylidene]hydrazinyl]-2-oxoacetate.
| Compound Name | butyl 2-[2-[(4-chlorophenyl)-[4-(trifluoromethylsulfonyloxy)phenyl]methylidene]hydrazinyl]-2-oxoacetate |
|---|---|
| PubChem CID | 139759334 |
| Molecular Formula | C20H18ClF3N2O6S |
| Molecular Weight | 506.89 g/mol |
| Exact Mass | 506.05 |
| IUPAC Name | butyl 2-[2-[(4-chlorophenyl)-[4-(trifluoromethylsulfonyloxy)phenyl]methylidene]hydrazinyl]-2-oxoacetate |
| SMILES | CCCCOC(=O)C(=O)NN=C(c1ccc(Cl)cc1)c1ccc(OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H18ClF3N2O6S/c1-2-3-12-31-19(28)18(27)26-25-17(13-4-8-15(21)9-5-13)14-6-10-16(11-7-14)32-33(29,30)20(22,23)24/h4-11H,2-3,12H2,1H3,(H,26,27) |
| InChIKey | SLWKDFGAFQQYCS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.89 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|