C25H37F3O7S — CID 19089339
dioctyl 4-(trifluoromethylsulfonyloxy)benzene-1,2-dicarboxylate (PubChem CID 19089339) has the molecular formula C25H37F3O7S and a molecular weight of 538.63 g/mol. Its IUPAC name is dioctyl 4-(trifluoromethylsulfonyloxy)benzene-1,2-dicarboxylate.
| Compound Name | dioctyl 4-(trifluoromethylsulfonyloxy)benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 19089339 |
| Molecular Formula | C25H37F3O7S |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | dioctyl 4-(trifluoromethylsulfonyloxy)benzene-1,2-dicarboxylate |
| SMILES | CCCCCCCCOC(=O)c1ccc(OS(=O)(=O)C(F)(F)F)cc1C(=O)OCCCCCCCC |
| InChI | InChI=1S/C25H37F3O7S/c1-3-5-7-9-11-13-17-33-23(29)21-16-15-20(35-36(31,32)25(26,27)28)19-22(21)24(30)34-18-14-12-10-8-6-4-2/h15-16,19H,3-14,17-18H2,1-2H3 |
| InChIKey | QAKUZVMINKKSSQ-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|