C36H50BaO14S2 — CID 87698769
barium(2+);bis(3,4-bis(pentoxycarbonyl)benzenesulfonate) (PubChem CID 87698769) has the molecular formula C36H50BaO14S2 and a molecular weight of 908.24 g/mol. Its IUPAC name is barium(2+);bis(3,4-bis(pentoxycarbonyl)benzenesulfonate).
| Compound Name | barium(2+);bis(3,4-bis(pentoxycarbonyl)benzenesulfonate) |
|---|---|
| PubChem CID | 87698769 |
| Molecular Formula | C36H50BaO14S2 |
| Molecular Weight | 908.24 g/mol |
| Exact Mass | 908.17 |
| IUPAC Name | barium(2+);bis(3,4-bis(pentoxycarbonyl)benzenesulfonate) |
| SMILES | CCCCCOC(=O)c1ccc(S(=O)(=O)[O-])cc1C(=O)OCCCCC.CCCCCOC(=O)c1ccc(S(=O)(=O)[O-])cc1C(=O)OCCCCC.[Ba+2] |
| InChI | InChI=1S/2C18H26O7S.Ba/c2*1-3-5-7-11-24-17(19)15-10-9-14(26(21,22)23)13-16(15)18(20)25-12-8-6-4-2;/h2*9-10,13H,3-8,11-12H2,1-2H3,(H,21,22,23);/q;;+2/p-2 |
| InChIKey | GBAAMKPKUFREHQ-UHFFFAOYSA-L |
| XLogP | 6.19 |
| TPSA | 219.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 908.24 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|