C42H69NaO7S — CID 101308737
sodium 3,4-bis[[(E)-heptadec-7-enoxy]carbonyl]benzenesulfonate (PubChem CID 101308737) has the molecular formula C42H69NaO7S and a molecular weight of 741.06 g/mol. Its IUPAC name is sodium 3,4-bis[[(E)-heptadec-7-enoxy]carbonyl]benzenesulfonate.
| Compound Name | sodium 3,4-bis[[(E)-heptadec-7-enoxy]carbonyl]benzenesulfonate |
|---|---|
| PubChem CID | 101308737 |
| Molecular Formula | C42H69NaO7S |
| Molecular Weight | 741.06 g/mol |
| Exact Mass | 740.47 |
| IUPAC Name | sodium 3,4-bis[[(E)-heptadec-7-enoxy]carbonyl]benzenesulfonate |
| SMILES | CCCCCCCCC/C=C/CCCCCCOC(=O)c1ccc(S(=O)(=O)[O-])cc1C(=O)OCCCCCC/C=C/CCCCCCCCC.[Na+] |
| InChI | InChI=1S/C42H70O7S.Na/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-35-48-41(43)39-34-33-38(50(45,46)47)37-40(39)42(44)49-36-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2;/h19-22,33-34,37H,3-18,23-32,35-36H2,1-2H3,(H,45,46,47);/q;+1/p-1/b21-19+,22-20+; |
| InChIKey | XSPJTSPLDQVJSM-ULQNKYRSSA-M |
| XLogP | 9.20 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.06 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|