C32H49NaO7S — CID 101308205
sodium 3,4-bis[[(E)-dodec-6-enoxy]carbonyl]benzenesulfonate (PubChem CID 101308205) has the molecular formula C32H49NaO7S and a molecular weight of 600.79 g/mol. Its IUPAC name is sodium 3,4-bis[[(E)-dodec-6-enoxy]carbonyl]benzenesulfonate.
| Compound Name | sodium 3,4-bis[[(E)-dodec-6-enoxy]carbonyl]benzenesulfonate |
|---|---|
| PubChem CID | 101308205 |
| Molecular Formula | C32H49NaO7S |
| Molecular Weight | 600.79 g/mol |
| Exact Mass | 600.31 |
| IUPAC Name | sodium 3,4-bis[[(E)-dodec-6-enoxy]carbonyl]benzenesulfonate |
| SMILES | CCCCC/C=C/CCCCCOC(=O)c1ccc(S(=O)(=O)[O-])cc1C(=O)OCCCCC/C=C/CCCCC.[Na+] |
| InChI | InChI=1S/C32H50O7S.Na/c1-3-5-7-9-11-13-15-17-19-21-25-38-31(33)29-24-23-28(40(35,36)37)27-30(29)32(34)39-26-22-20-18-16-14-12-10-8-6-4-2;/h11-14,23-24,27H,3-10,15-22,25-26H2,1-2H3,(H,35,36,37);/q;+1/p-1/b13-11+,14-12+; |
| InChIKey | IWAWVYTUYHHGNU-JZOPPWQGSA-M |
| XLogP | 5.30 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.79 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|