C24H40O8S — CID 162321790
dioctyl benzene-1,2-dicarboxylate;sulfuric acid (PubChem CID 162321790) has the molecular formula C24H40O8S and a molecular weight of 488.64 g/mol. Its IUPAC name is dioctyl benzene-1,2-dicarboxylate;sulfuric acid.
| Compound Name | dioctyl benzene-1,2-dicarboxylate;sulfuric acid |
|---|---|
| PubChem CID | 162321790 |
| Molecular Formula | C24H40O8S |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | dioctyl benzene-1,2-dicarboxylate;sulfuric acid |
| SMILES | CCCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCC.O=S(=O)(O)O |
| InChI | InChI=1S/C24H38O4.H2O4S/c1-3-5-7-9-11-15-19-27-23(25)21-17-13-14-18-22(21)24(26)28-20-16-12-10-8-6-4-2;1-5(2,3)4/h13-14,17-18H,3-12,15-16,19-20H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | DAOUVKSHEHYOEW-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|