C18H26O7S — CID 101304628
2-(2-octoxycarbonylbenzoyl)oxyethanesulfonic acid (PubChem CID 101304628) has the molecular formula C18H26O7S and a molecular weight of 386.47 g/mol. Its IUPAC name is 2-(2-octoxycarbonylbenzoyl)oxyethanesulfonic acid.
| Compound Name | 2-(2-octoxycarbonylbenzoyl)oxyethanesulfonic acid |
|---|---|
| PubChem CID | 101304628 |
| Molecular Formula | C18H26O7S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 2-(2-octoxycarbonylbenzoyl)oxyethanesulfonic acid |
| SMILES | CCCCCCCCOC(=O)c1ccccc1C(=O)OCCS(=O)(=O)O |
| InChI | InChI=1S/C18H26O7S/c1-2-3-4-5-6-9-12-24-17(19)15-10-7-8-11-16(15)18(20)25-13-14-26(21,22)23/h7-8,10-11H,2-6,9,12-14H2,1H3,(H,21,22,23) |
| InChIKey | BTJPUTRBQSVVTD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|