C24H20ClF3N2O5S — CID 139990964
[4-[1-(4-chlorophenyl)-2-(ethoxycarbonylhydrazinylidene)-2-phenylethyl]phenyl] trifluoromethanesulfonate (PubChem CID 139990964) has the molecular formula C24H20ClF3N2O5S and a molecular weight of 540.95 g/mol. Its IUPAC name is [4-[1-(4-chlorophenyl)-2-(ethoxycarbonylhydrazinylidene)-2-phenylethyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[1-(4-chlorophenyl)-2-(ethoxycarbonylhydrazinylidene)-2-phenylethyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139990964 |
| Molecular Formula | C24H20ClF3N2O5S |
| Molecular Weight | 540.95 g/mol |
| Exact Mass | 540.07 |
| IUPAC Name | [4-[1-(4-chlorophenyl)-2-(ethoxycarbonylhydrazinylidene)-2-phenylethyl]phenyl] trifluoromethanesulfonate |
| SMILES | CCOC(=O)NN=C(c1ccccc1)C(c1ccc(Cl)cc1)c1ccc(OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H20ClF3N2O5S/c1-2-34-23(31)30-29-22(18-6-4-3-5-7-18)21(16-8-12-19(25)13-9-16)17-10-14-20(15-11-17)35-36(32,33)24(26,27)28/h3-15,21H,2H2,1H3,(H,30,31) |
| InChIKey | GXJNVTSQLRNVDL-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.95 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|