C11H13ClN2O3 — CID 86662431
ethyl N-[[1-(4-chlorophenyl)-2-hydroxyethylidene]amino]carbamate (PubChem CID 86662431) has the molecular formula C11H13ClN2O3 and a molecular weight of 256.69 g/mol. Its IUPAC name is ethyl N-[[1-(4-chlorophenyl)-2-hydroxyethylidene]amino]carbamate.
| Compound Name | ethyl N-[[1-(4-chlorophenyl)-2-hydroxyethylidene]amino]carbamate |
|---|---|
| PubChem CID | 86662431 |
| Molecular Formula | C11H13ClN2O3 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | ethyl N-[[1-(4-chlorophenyl)-2-hydroxyethylidene]amino]carbamate |
| SMILES | CCOC(=O)NN=C(CO)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H13ClN2O3/c1-2-17-11(16)14-13-10(7-15)8-3-5-9(12)6-4-8/h3-6,15H,2,7H2,1H3,(H,14,16) |
| InChIKey | OZLRSDQWUFHZGQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|