C11H10Cl3NO2 — CID 621078
ethyl N-[2,2-dichloro-1-(4-chlorophenyl)ethenyl]carbamate (PubChem CID 621078) has the molecular formula C11H10Cl3NO2 and a molecular weight of 294.57 g/mol. Its IUPAC name is ethyl N-[2,2-dichloro-1-(4-chlorophenyl)ethenyl]carbamate.
| Compound Name | ethyl N-[2,2-dichloro-1-(4-chlorophenyl)ethenyl]carbamate |
|---|---|
| PubChem CID | 621078 |
| Molecular Formula | C11H10Cl3NO2 |
| Molecular Weight | 294.57 g/mol |
| Exact Mass | 292.98 |
| IUPAC Name | ethyl N-[2,2-dichloro-1-(4-chlorophenyl)ethenyl]carbamate |
| SMILES | CCOC(=O)NC(=C(Cl)Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H10Cl3NO2/c1-2-17-11(16)15-9(10(13)14)7-3-5-8(12)6-4-7/h3-6H,2H2,1H3,(H,15,16) |
| InChIKey | MKPUJEQPRLSXIT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.57 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |