C25H30N2O3 — CID 146037847
butyl 2-(2-benzhydrylidenehydrazinyl)-5,5-dimethyl-4-oxohex-2-enoate (PubChem CID 146037847) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is butyl 2-(2-benzhydrylidenehydrazinyl)-5,5-dimethyl-4-oxohex-2-enoate.
| Compound Name | butyl 2-(2-benzhydrylidenehydrazinyl)-5,5-dimethyl-4-oxohex-2-enoate |
|---|---|
| PubChem CID | 146037847 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | butyl 2-(2-benzhydrylidenehydrazinyl)-5,5-dimethyl-4-oxohex-2-enoate |
| SMILES | CCCCOC(=O)C(=CC(=O)C(C)(C)C)NN=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H30N2O3/c1-5-6-17-30-24(29)21(18-22(28)25(2,3)4)26-27-23(19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-16,18,26H,5-6,17H2,1-4H3 |
| InChIKey | AAJIZYUTKQJSCE-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|