C16H21NO3 — CID 11492804
N-[(Z)-1-ethoxy-4,4-dimethyl-3-oxopent-1-enyl]benzamide (PubChem CID 11492804) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is N-[(Z)-1-ethoxy-4,4-dimethyl-3-oxopent-1-enyl]benzamide.
| Compound Name | N-[(Z)-1-ethoxy-4,4-dimethyl-3-oxopent-1-enyl]benzamide |
|---|---|
| PubChem CID | 11492804 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | N-[(Z)-1-ethoxy-4,4-dimethyl-3-oxopent-1-enyl]benzamide |
| SMILES | CCO/C(=C\C(=O)C(C)(C)C)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H21NO3/c1-5-20-14(11-13(18)16(2,3)4)17-15(19)12-9-7-6-8-10-12/h6-11H,5H2,1-4H3,(H,17,19)/b14-11- |
| InChIKey | FKGNVAXDHAZTHX-KAMYIIQDSA-N |
| XLogP | 2.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|