C21H22N2O4 — CID 6377265
ethyl (E)-4,5-dibenzamidopent-4-enoate (PubChem CID 6377265) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is ethyl (E)-4,5-dibenzamidopent-4-enoate.
| Compound Name | ethyl (E)-4,5-dibenzamidopent-4-enoate |
|---|---|
| PubChem CID | 6377265 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | ethyl (E)-4,5-dibenzamidopent-4-enoate |
| SMILES | CCOC(=O)CC/C(=C\NC(=O)c1ccccc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H22N2O4/c1-2-27-19(24)14-13-18(23-21(26)17-11-7-4-8-12-17)15-22-20(25)16-9-5-3-6-10-16/h3-12,15H,2,13-14H2,1H3,(H,22,25)(H,23,26)/b18-15+ |
| InChIKey | MENJFTDXBZFZAN-OBGWFSINSA-N |
| XLogP | 3.03 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |