About N-oct-2-en-3-ylbenzamide
N-oct-2-en-3-ylbenzamide (PubChem CID 69089961) has the molecular formula C15H21NO
and a molecular weight of 231.34 g/mol. Its IUPAC name is N-oct-2-en-3-ylbenzamide.
Molecular Properties
| Compound Name | N-oct-2-en-3-ylbenzamide |
| PubChem CID | 69089961 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | N-oct-2-en-3-ylbenzamide |
| SMILES | CC=C(CCCCC)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H21NO/c1-3-5-7-12-14(4-2)16-15(17)13-10-8-6-9-11-13/h4,6,8-11H,3,5,7,12H2,1-2H3,(H,16,17) |
| InChIKey | RDKJNMODZXHVFU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-oct-2-en-3-ylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-oct-2-en-3-ylbenzamide?
The IUPAC name of N-oct-2-en-3-ylbenzamide (CID 69089961) is N-oct-2-en-3-ylbenzamide.
What is the SMILES notation for N-oct-2-en-3-ylbenzamide?
The canonical SMILES for N-oct-2-en-3-ylbenzamide is CC=C(CCCCC)NC(=O)c1ccccc1.
What is the InChIKey of N-oct-2-en-3-ylbenzamide?
The InChIKey is RDKJNMODZXHVFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO/c1-3-5-7-12-14(4-2)16-15(17)13-10-8-6-9-11-13/h4,6,8-11H,3,5,7,12H2,1-2H3,(H,16,17).
What are the key properties of N-oct-2-en-3-ylbenzamide?
N-oct-2-en-3-ylbenzamide has a molecular weight of 231.34 g/mol, XLogP of 3.90, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-oct-2-en-3-ylbenzamide is sourced from PubChem (CID 69089961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).