About N-butanimidoylbenzamide
N-butanimidoylbenzamide (PubChem CID 174644030) has the molecular formula C11H14N2O
and a molecular weight of 190.25 g/mol. Its IUPAC name is N-butanimidoylbenzamide.
Molecular Properties
| Compound Name | N-butanimidoylbenzamide |
| PubChem CID | 174644030 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | N-butanimidoylbenzamide |
| SMILES | [H]/N=C(\CCC)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C11H14N2O/c1-2-6-10(12)13-11(14)9-7-4-3-5-8-9/h3-5,7-8H,2,6H2,1H3,(H2,12,13,14) |
| InChIKey | IIAKVBSYACIPHU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-butanimidoylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butanimidoylbenzamide?
The IUPAC name of N-butanimidoylbenzamide (CID 174644030) is N-butanimidoylbenzamide.
What is the SMILES notation for N-butanimidoylbenzamide?
The canonical SMILES for N-butanimidoylbenzamide is [H]/N=C(\CCC)NC(=O)c1ccccc1.
What is the InChIKey of N-butanimidoylbenzamide?
The InChIKey is IIAKVBSYACIPHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O/c1-2-6-10(12)13-11(14)9-7-4-3-5-8-9/h3-5,7-8H,2,6H2,1H3,(H2,12,13,14).
What are the key properties of N-butanimidoylbenzamide?
N-butanimidoylbenzamide has a molecular weight of 190.25 g/mol, XLogP of 2.19, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butanimidoylbenzamide is sourced from PubChem (CID 174644030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).