C17H14ClF3N2O6S2 — CID 139763669
[4-[N-[acetyl(methylsulfonyl)amino]-C-(4-chlorophenyl)carbonimidoyl]phenyl] trifluoromethanesulfonate (PubChem CID 139763669) has the molecular formula C17H14ClF3N2O6S2 and a molecular weight of 498.89 g/mol. Its IUPAC name is [4-[N-[acetyl(methylsulfonyl)amino]-C-(4-chlorophenyl)carbonimidoyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[N-[acetyl(methylsulfonyl)amino]-C-(4-chlorophenyl)carbonimidoyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139763669 |
| Molecular Formula | C17H14ClF3N2O6S2 |
| Molecular Weight | 498.89 g/mol |
| Exact Mass | 497.99 |
| IUPAC Name | [4-[N-[acetyl(methylsulfonyl)amino]-C-(4-chlorophenyl)carbonimidoyl]phenyl] trifluoromethanesulfonate |
| SMILES | CC(=O)N(N=C(c1ccc(Cl)cc1)c1ccc(OS(=O)(=O)C(F)(F)F)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C17H14ClF3N2O6S2/c1-11(24)23(30(2,25)26)22-16(12-3-7-14(18)8-4-12)13-5-9-15(10-6-13)29-31(27,28)17(19,20)21/h3-10H,1-2H3 |
| InChIKey | RCIQEZORIUTJEH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 110.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.89 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|