C11H14F3NO5S — CID 173103797
N,N-dimethylmethanamine;4-(trifluoromethylsulfonyloxy)benzoic acid (PubChem CID 173103797) has the molecular formula C11H14F3NO5S and a molecular weight of 329.30 g/mol. Its IUPAC name is N,N-dimethylmethanamine;4-(trifluoromethylsulfonyloxy)benzoic acid.
| Compound Name | N,N-dimethylmethanamine;4-(trifluoromethylsulfonyloxy)benzoic acid |
|---|---|
| PubChem CID | 173103797 |
| Molecular Formula | C11H14F3NO5S |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | N,N-dimethylmethanamine;4-(trifluoromethylsulfonyloxy)benzoic acid |
| SMILES | CN(C)C.O=C(O)c1ccc(OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C8H5F3O5S.C3H9N/c9-8(10,11)17(14,15)16-6-3-1-5(2-4-6)7(12)13;1-4(2)3/h1-4H,(H,12,13);1-3H3 |
| InChIKey | DTGQCUQAXLQLAV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|