C16H11Cl2F3O — CID 164684484
(2R)-1,2-bis(4-chlorophenyl)-4,4,4-trifluorobutan-1-one (PubChem CID 164684484) has the molecular formula C16H11Cl2F3O and a molecular weight of 347.16 g/mol. Its IUPAC name is (2R)-1,2-bis(4-chlorophenyl)-4,4,4-trifluorobutan-1-one.
| Compound Name | (2R)-1,2-bis(4-chlorophenyl)-4,4,4-trifluorobutan-1-one |
|---|---|
| PubChem CID | 164684484 |
| Molecular Formula | C16H11Cl2F3O |
| Molecular Weight | 347.16 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | (2R)-1,2-bis(4-chlorophenyl)-4,4,4-trifluorobutan-1-one |
| SMILES | O=C(c1ccc(Cl)cc1)[C@H](CC(F)(F)F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H11Cl2F3O/c17-12-5-1-10(2-6-12)14(9-16(19,20)21)15(22)11-3-7-13(18)8-4-11/h1-8,14H,9H2/t14-/m1/s1 |
| InChIKey | IARCMXYZAMXTOJ-CQSZACIVSA-N |
| XLogP | 5.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.16 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |