C19H16F4O3 — CID 122395328
ethyl (4S)-2,2-difluoro-4,5-bis(4-fluorophenyl)-5-oxopentanoate (PubChem CID 122395328) has the molecular formula C19H16F4O3 and a molecular weight of 368.33 g/mol. Its IUPAC name is ethyl (4S)-2,2-difluoro-4,5-bis(4-fluorophenyl)-5-oxopentanoate.
| Compound Name | ethyl (4S)-2,2-difluoro-4,5-bis(4-fluorophenyl)-5-oxopentanoate |
|---|---|
| PubChem CID | 122395328 |
| Molecular Formula | C19H16F4O3 |
| Molecular Weight | 368.33 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | ethyl (4S)-2,2-difluoro-4,5-bis(4-fluorophenyl)-5-oxopentanoate |
| SMILES | CCOC(=O)C(F)(F)C[C@H](C(=O)c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H16F4O3/c1-2-26-18(25)19(22,23)11-16(12-3-7-14(20)8-4-12)17(24)13-5-9-15(21)10-6-13/h3-10,16H,2,11H2,1H3/t16-/m0/s1 |
| InChIKey | TZTKWSAMXRWNNQ-INIZCTEOSA-N |
| XLogP | 4.52 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.33 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |