C12H10BrF3O2 — CID 125477866
ethyl (Z)-4-bromo-2,2-difluoro-4-(4-fluorophenyl)but-3-enoate (PubChem CID 125477866) has the molecular formula C12H10BrF3O2 and a molecular weight of 323.11 g/mol. Its IUPAC name is ethyl (Z)-4-bromo-2,2-difluoro-4-(4-fluorophenyl)but-3-enoate.
| Compound Name | ethyl (Z)-4-bromo-2,2-difluoro-4-(4-fluorophenyl)but-3-enoate |
|---|---|
| PubChem CID | 125477866 |
| Molecular Formula | C12H10BrF3O2 |
| Molecular Weight | 323.11 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | ethyl (Z)-4-bromo-2,2-difluoro-4-(4-fluorophenyl)but-3-enoate |
| SMILES | CCOC(=O)C(F)(F)/C=C(\Br)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H10BrF3O2/c1-2-18-11(17)12(15,16)7-10(13)8-3-5-9(14)6-4-8/h3-7H,2H2,1H3/b10-7- |
| InChIKey | VYBMAQWBDHIUPZ-YFHOEESVSA-N |
| XLogP | 3.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.11 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |