C18H24FNO5 — CID 174602086
3-O-tert-butyl 1-O-ethyl 2-amino-2-[3-(4-fluorophenyl)-3-oxopropyl]propanedioate (PubChem CID 174602086) has the molecular formula C18H24FNO5 and a molecular weight of 353.39 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-ethyl 2-amino-2-[3-(4-fluorophenyl)-3-oxopropyl]propanedioate.
| Compound Name | 3-O-tert-butyl 1-O-ethyl 2-amino-2-[3-(4-fluorophenyl)-3-oxopropyl]propanedioate |
|---|---|
| PubChem CID | 174602086 |
| Molecular Formula | C18H24FNO5 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 3-O-tert-butyl 1-O-ethyl 2-amino-2-[3-(4-fluorophenyl)-3-oxopropyl]propanedioate |
| SMILES | CCOC(=O)C(N)(CCC(=O)c1ccc(F)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H24FNO5/c1-5-24-15(22)18(20,16(23)25-17(2,3)4)11-10-14(21)12-6-8-13(19)9-7-12/h6-9H,5,10-11,20H2,1-4H3 |
| InChIKey | JJVCLJBOZFSVSM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|