C10H5ClF7NO4S — CID 125493012
(4-chlorophenyl) N-(2,2,3,3,4,4,4-heptafluorobutanoyl)sulfamate (PubChem CID 125493012) has the molecular formula C10H5ClF7NO4S and a molecular weight of 403.66 g/mol. Its IUPAC name is (4-chlorophenyl) N-(2,2,3,3,4,4,4-heptafluorobutanoyl)sulfamate.
| Compound Name | (4-chlorophenyl) N-(2,2,3,3,4,4,4-heptafluorobutanoyl)sulfamate |
|---|---|
| PubChem CID | 125493012 |
| Molecular Formula | C10H5ClF7NO4S |
| Molecular Weight | 403.66 g/mol |
| Exact Mass | 402.95 |
| IUPAC Name | (4-chlorophenyl) N-(2,2,3,3,4,4,4-heptafluorobutanoyl)sulfamate |
| SMILES | O=C(NS(=O)(=O)Oc1ccc(Cl)cc1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H5ClF7NO4S/c11-5-1-3-6(4-2-5)23-24(21,22)19-7(20)8(12,13)9(14,15)10(16,17)18/h1-4H,(H,19,20) |
| InChIKey | JFPOJRKSHNMRDK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.66 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|