C17H9F18NO4S2 — CID 100944008
S-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl) N-(4-fluorophenoxy)sulfonylcarbamothioate (PubChem CID 100944008) has the molecular formula C17H9F18NO4S2 and a molecular weight of 697.36 g/mol. Its IUPAC name is S-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl) N-(4-fluorophenoxy)sulfonylcarbamothioate.
| Compound Name | S-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl) N-(4-fluorophenoxy)sulfonylcarbamothioate |
|---|---|
| PubChem CID | 100944008 |
| Molecular Formula | C17H9F18NO4S2 |
| Molecular Weight | 697.36 g/mol |
| Exact Mass | 696.97 |
| IUPAC Name | S-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl) N-(4-fluorophenoxy)sulfonylcarbamothioate |
| SMILES | O=C(NS(=O)(=O)Oc1ccc(F)cc1)SCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H9F18NO4S2/c18-7-1-3-8(4-2-7)40-42(38,39)36-9(37)41-6-5-10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)15(29,30)16(31,32)17(33,34)35/h1-4H,5-6H2,(H,36,37) |
| InChIKey | BRLYRITWULRDJS-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.36 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|