C21H13F13OS — CID 100972970
S-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) 4-phenylbenzenecarbothioate (PubChem CID 100972970) has the molecular formula C21H13F13OS and a molecular weight of 560.38 g/mol. Its IUPAC name is S-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) 4-phenylbenzenecarbothioate.
| Compound Name | S-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) 4-phenylbenzenecarbothioate |
|---|---|
| PubChem CID | 100972970 |
| Molecular Formula | C21H13F13OS |
| Molecular Weight | 560.38 g/mol |
| Exact Mass | 560.05 |
| IUPAC Name | S-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) 4-phenylbenzenecarbothioate |
| SMILES | O=C(SCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H13F13OS/c22-16(23,17(24,25)18(26,27)19(28,29)20(30,31)21(32,33)34)10-11-36-15(35)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-9H,10-11H2 |
| InChIKey | LCYSLLFCHWGPJM-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.38 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|