C22H16F13N — CID 102094259
1-(4-phenylphenyl)-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)ethanimine (PubChem CID 102094259) has the molecular formula C22H16F13N and a molecular weight of 541.35 g/mol. Its IUPAC name is 1-(4-phenylphenyl)-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)ethanimine.
| Compound Name | 1-(4-phenylphenyl)-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)ethanimine |
|---|---|
| PubChem CID | 102094259 |
| Molecular Formula | C22H16F13N |
| Molecular Weight | 541.35 g/mol |
| Exact Mass | 541.11 |
| IUPAC Name | 1-(4-phenylphenyl)-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)ethanimine |
| SMILES | C/C(=N\CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H16F13N/c1-13(14-7-9-16(10-8-14)15-5-3-2-4-6-15)36-12-11-17(23,24)18(25,26)19(27,28)20(29,30)21(31,32)22(33,34)35/h2-10H,11-12H2,1H3/b36-13+ |
| InChIKey | GWPJJEYASOMLKQ-FIFHTESVSA-N |
| XLogP | 8.29 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.35 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|