C22H13F26P — CID 10855350
phenyl-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)phosphane (PubChem CID 10855350) has the molecular formula C22H13F26P and a molecular weight of 802.27 g/mol. Its IUPAC name is phenyl-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)phosphane.
| Compound Name | phenyl-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)phosphane |
|---|---|
| PubChem CID | 10855350 |
| Molecular Formula | C22H13F26P |
| Molecular Weight | 802.27 g/mol |
| Exact Mass | 802.03 |
| IUPAC Name | phenyl-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)phosphane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCP(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C22H13F26P/c23-11(24,13(27,28)15(31,32)17(35,36)19(39,40)21(43,44)45)6-8-49(10-4-2-1-3-5-10)9-7-12(25,26)14(29,30)16(33,34)18(37,38)20(41,42)22(46,47)48/h1-5H,6-9H2 |
| InChIKey | HKZQZMKTYFUILT-UHFFFAOYSA-N |
| XLogP | 11.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.27 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|