C38H30F34N2 — CID 11815681
N,N'-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-N,N'-bis[(1S)-1-phenylethyl]ethane-1,2-diamine (PubChem CID 11815681) has the molecular formula C38H30F34N2 and a molecular weight of 1160.60 g/mol. Its IUPAC name is N,N'-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-N,N'-bis[(1S)-1-phenylethyl]ethane-1,2-diamine.
| Compound Name | N,N'-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-N,N'-bis[(1S)-1-phenylethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 11815681 |
| Molecular Formula | C38H30F34N2 |
| Molecular Weight | 1160.60 g/mol |
| Exact Mass | 1160.19 |
| IUPAC Name | N,N'-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-N,N'-bis[(1S)-1-phenylethyl]ethane-1,2-diamine |
| SMILES | C[C@@H](c1ccccc1)N(CCN(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)[C@@H](C)c1ccccc1)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C38H30F34N2/c1-19(21-9-5-3-6-10-21)73(15-13-23(39,40)25(43,44)27(47,48)29(51,52)31(55,56)33(59,60)35(63,64)37(67,68)69)17-18-74(20(2)22-11-7-4-8-12-22)16-14-24(41,42)26(45,46)28(49,50)30(53,54)32(57,58)34(61,62)36(65,66)38(70,71)72/h3-12,19-20H,13-18H2,1-2H3/t19-,20-/m0/s1 |
| InChIKey | BMSTZPFHLICEGU-PMACEKPBSA-N |
| XLogP | 15.91 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1160.60 |
| LogP ≤ 5 | 15.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|