C21H17F19O2 — CID 175044031
(1-tert-butylperoxy-3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-nonadecafluoroundecyl)benzene (PubChem CID 175044031) has the molecular formula C21H17F19O2 and a molecular weight of 662.33 g/mol. Its IUPAC name is (1-tert-butylperoxy-3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-nonadecafluoroundecyl)benzene.
| Compound Name | (1-tert-butylperoxy-3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-nonadecafluoroundecyl)benzene |
|---|---|
| PubChem CID | 175044031 |
| Molecular Formula | C21H17F19O2 |
| Molecular Weight | 662.33 g/mol |
| Exact Mass | 662.09 |
| IUPAC Name | (1-tert-butylperoxy-3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-nonadecafluoroundecyl)benzene |
| SMILES | CC(C)(C)OOC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C21H17F19O2/c1-12(2,3)42-41-11(10-7-5-4-6-8-10)9-13(22,23)14(24,25)15(26,27)16(28,29)17(30,31)18(32,33)19(34,35)20(36,37)21(38,39)40/h4-8,11H,9H2,1-3H3 |
| InChIKey | FQRPTGSNCMYVER-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.33 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|