C17H19F9O3 — CID 132512772
1-(1-tert-butylperoxy-3,3,4,4,5,5,6,6,6-nonafluorohexyl)-2-methoxybenzene (PubChem CID 132512772) has the molecular formula C17H19F9O3 and a molecular weight of 442.32 g/mol. Its IUPAC name is 1-(1-tert-butylperoxy-3,3,4,4,5,5,6,6,6-nonafluorohexyl)-2-methoxybenzene.
| Compound Name | 1-(1-tert-butylperoxy-3,3,4,4,5,5,6,6,6-nonafluorohexyl)-2-methoxybenzene |
|---|---|
| PubChem CID | 132512772 |
| Molecular Formula | C17H19F9O3 |
| Molecular Weight | 442.32 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 1-(1-tert-butylperoxy-3,3,4,4,5,5,6,6,6-nonafluorohexyl)-2-methoxybenzene |
| SMILES | COc1ccccc1C(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OOC(C)(C)C |
| InChI | InChI=1S/C17H19F9O3/c1-13(2,3)29-28-12(10-7-5-6-8-11(10)27-4)9-14(18,19)15(20,21)16(22,23)17(24,25)26/h5-8,12H,9H2,1-4H3 |
| InChIKey | MHGWGJQSCKSICL-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.32 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|