C17H19F9O2 — CID 132512770
1-(1-tert-butylperoxy-3,3,4,4,5,5,6,6,6-nonafluorohexyl)-2-methylbenzene (PubChem CID 132512770) has the molecular formula C17H19F9O2 and a molecular weight of 426.32 g/mol. Its IUPAC name is 1-(1-tert-butylperoxy-3,3,4,4,5,5,6,6,6-nonafluorohexyl)-2-methylbenzene.
| Compound Name | 1-(1-tert-butylperoxy-3,3,4,4,5,5,6,6,6-nonafluorohexyl)-2-methylbenzene |
|---|---|
| PubChem CID | 132512770 |
| Molecular Formula | C17H19F9O2 |
| Molecular Weight | 426.32 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 1-(1-tert-butylperoxy-3,3,4,4,5,5,6,6,6-nonafluorohexyl)-2-methylbenzene |
| SMILES | Cc1ccccc1C(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OOC(C)(C)C |
| InChI | InChI=1S/C17H19F9O2/c1-10-7-5-6-8-11(10)12(27-28-13(2,3)4)9-14(18,19)15(20,21)16(22,23)17(24,25)26/h5-8,12H,9H2,1-4H3 |
| InChIKey | LOJOEYAXFWVSKQ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.32 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|