C15H13F9O3 — CID 156765270
methyl 2-(3,3,4,4,5,5,6,6,6-nonafluoro-1-methoxyhexyl)benzoate (PubChem CID 156765270) has the molecular formula C15H13F9O3 and a molecular weight of 412.25 g/mol. Its IUPAC name is methyl 2-(3,3,4,4,5,5,6,6,6-nonafluoro-1-methoxyhexyl)benzoate.
| Compound Name | methyl 2-(3,3,4,4,5,5,6,6,6-nonafluoro-1-methoxyhexyl)benzoate |
|---|---|
| PubChem CID | 156765270 |
| Molecular Formula | C15H13F9O3 |
| Molecular Weight | 412.25 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | methyl 2-(3,3,4,4,5,5,6,6,6-nonafluoro-1-methoxyhexyl)benzoate |
| SMILES | COC(=O)c1ccccc1C(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OC |
| InChI | InChI=1S/C15H13F9O3/c1-26-10(8-5-3-4-6-9(8)11(25)27-2)7-12(16,17)13(18,19)14(20,21)15(22,23)24/h3-6,10H,7H2,1-2H3 |
| InChIKey | WNRHZXPBRPKTBZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.25 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|