C16H11F9O2 — CID 153324368
methyl 2-(5,5,6,6,7,7,8,8,8-nonafluorooct-1-ynyl)benzoate (PubChem CID 153324368) has the molecular formula C16H11F9O2 and a molecular weight of 406.24 g/mol. Its IUPAC name is methyl 2-(5,5,6,6,7,7,8,8,8-nonafluorooct-1-ynyl)benzoate.
| Compound Name | methyl 2-(5,5,6,6,7,7,8,8,8-nonafluorooct-1-ynyl)benzoate |
|---|---|
| PubChem CID | 153324368 |
| Molecular Formula | C16H11F9O2 |
| Molecular Weight | 406.24 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | methyl 2-(5,5,6,6,7,7,8,8,8-nonafluorooct-1-ynyl)benzoate |
| SMILES | COC(=O)c1ccccc1C#CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H11F9O2/c1-27-12(26)11-8-3-2-6-10(11)7-4-5-9-13(17,18)14(19,20)15(21,22)16(23,24)25/h2-3,6,8H,5,9H2,1H3 |
| InChIKey | UJQTVYXNFFGEDG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.24 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|