C12H7F7O3 — CID 146010980
methyl 2-(2,2,3,3,4,4,4-heptafluorobutanoyl)benzoate (PubChem CID 146010980) has the molecular formula C12H7F7O3 and a molecular weight of 332.17 g/mol. Its IUPAC name is methyl 2-(2,2,3,3,4,4,4-heptafluorobutanoyl)benzoate.
| Compound Name | methyl 2-(2,2,3,3,4,4,4-heptafluorobutanoyl)benzoate |
|---|---|
| PubChem CID | 146010980 |
| Molecular Formula | C12H7F7O3 |
| Molecular Weight | 332.17 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | methyl 2-(2,2,3,3,4,4,4-heptafluorobutanoyl)benzoate |
| SMILES | COC(=O)c1ccccc1C(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H7F7O3/c1-22-9(21)7-5-3-2-4-6(7)8(20)10(13,14)11(15,16)12(17,18)19/h2-5H,1H3 |
| InChIKey | LKVVQUXZTGPDSX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.17 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|