methyl 4-(2,2,3,3,4,4,4-heptafluorobutanoyl)benzoate

C12H7F7O3 — CID 146011064

IUPACmethyl 4-(2,2,3,3,4,4,4-heptafluorobutanoyl)benzoate
SMILESCOC(=O)c1ccc(C(=O)C(F)(F)C(F)(F)C(F)(F)F)cc1
InChIInChI=1S/C12H7F7O3/c1-22-9(21)7-4-2-6(3-5-7)8(20)10(13,14)11(15,16)12(17,18)19/h2-5H,1H3
InChIKeyRIPHOWQKDDPROL-UHFFFAOYSA-N
MW332.17 g/mol
LogP3.49
Rot. Bonds4

About methyl 4-(2,2,3,3,4,4,4-heptafluorobutanoyl)benzoate

methyl 4-(2,2,3,3,4,4,4-heptafluorobutanoyl)benzoate (PubChem CID 146011064) has the molecular formula C12H7F7O3 and a molecular weight of 332.17 g/mol. Its IUPAC name is methyl 4-(2,2,3,3,4,4,4-heptafluorobutanoyl)benzoate.

Molecular Properties

Compound Namemethyl 4-(2,2,3,3,4,4,4-heptafluorobutanoyl)benzoate
PubChem CID146011064
Molecular FormulaC12H7F7O3
Molecular Weight332.17 g/mol
Exact Mass332.03
IUPAC Namemethyl 4-(2,2,3,3,4,4,4-heptafluorobutanoyl)benzoate
SMILESCOC(=O)c1ccc(C(=O)C(F)(F)C(F)(F)C(F)(F)F)cc1
InChIInChI=1S/C12H7F7O3/c1-22-9(21)7-4-2-6(3-5-7)8(20)10(13,14)11(15,16)12(17,18)19/h2-5H,1H3
InChIKeyRIPHOWQKDDPROL-UHFFFAOYSA-N
XLogP3.49
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500332.17
LogP ≤ 53.49
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}

Analyze methyl 4-(2,2,3,3,4,4,4-heptafluorobutanoyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(2,2,3,3,4,4,4-heptafluorobutanoyl)benzoate?
The IUPAC name of methyl 4-(2,2,3,3,4,4,4-heptafluorobutanoyl)benzoate (CID 146011064) is methyl 4-(2,2,3,3,4,4,4-heptafluorobutanoyl)benzoate.
What is the SMILES notation for methyl 4-(2,2,3,3,4,4,4-heptafluorobutanoyl)benzoate?
The canonical SMILES for methyl 4-(2,2,3,3,4,4,4-heptafluorobutanoyl)benzoate is COC(=O)c1ccc(C(=O)C(F)(F)C(F)(F)C(F)(F)F)cc1.
What is the InChIKey of methyl 4-(2,2,3,3,4,4,4-heptafluorobutanoyl)benzoate?
The InChIKey is RIPHOWQKDDPROL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7F7O3/c1-22-9(21)7-4-2-6(3-5-7)8(20)10(13,14)11(15,16)12(17,18)19/h2-5H,1H3.
What are the key properties of methyl 4-(2,2,3,3,4,4,4-heptafluorobutanoyl)benzoate?
methyl 4-(2,2,3,3,4,4,4-heptafluorobutanoyl)benzoate has a molecular weight of 332.17 g/mol, XLogP of 3.49, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(2,2,3,3,4,4,4-heptafluorobutanoyl)benzoate is sourced from PubChem (CID 146011064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).