methyl 4-[4-(1,1,2,2,2-pentafluoroethyl)phenoxy]benzoate

C16H11F5O3 — CID 142415405

IUPACmethyl 4-[4-(1,1,2,2,2-pentafluoroethyl)phenoxy]benzoate
SMILESCOC(=O)c1ccc(Oc2ccc(C(F)(F)C(F)(F)F)cc2)cc1
InChIInChI=1S/C16H11F5O3/c1-23-14(22)10-2-6-12(7-3-10)24-13-8-4-11(5-9-13)15(17,18)16(19,20)21/h2-9H,1H3
InChIKeyMNDMTLIFMRXVRJ-UHFFFAOYSA-N
MW346.25 g/mol
LogP4.92
Rot. Bonds4

About methyl 4-[4-(1,1,2,2,2-pentafluoroethyl)phenoxy]benzoate

methyl 4-[4-(1,1,2,2,2-pentafluoroethyl)phenoxy]benzoate (PubChem CID 142415405) has the molecular formula C16H11F5O3 and a molecular weight of 346.25 g/mol. Its IUPAC name is methyl 4-[4-(1,1,2,2,2-pentafluoroethyl)phenoxy]benzoate.

Molecular Properties

Compound Namemethyl 4-[4-(1,1,2,2,2-pentafluoroethyl)phenoxy]benzoate
PubChem CID142415405
Molecular FormulaC16H11F5O3
Molecular Weight346.25 g/mol
Exact Mass346.06
IUPAC Namemethyl 4-[4-(1,1,2,2,2-pentafluoroethyl)phenoxy]benzoate
SMILESCOC(=O)c1ccc(Oc2ccc(C(F)(F)C(F)(F)F)cc2)cc1
InChIInChI=1S/C16H11F5O3/c1-23-14(22)10-2-6-12(7-3-10)24-13-8-4-11(5-9-13)15(17,18)16(19,20)21/h2-9H,1H3
InChIKeyMNDMTLIFMRXVRJ-UHFFFAOYSA-N
XLogP4.92
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500346.25
LogP ≤ 54.92
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}

Analyze methyl 4-[4-(1,1,2,2,2-pentafluoroethyl)phenoxy]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[4-(1,1,2,2,2-pentafluoroethyl)phenoxy]benzoate?
The IUPAC name of methyl 4-[4-(1,1,2,2,2-pentafluoroethyl)phenoxy]benzoate (CID 142415405) is methyl 4-[4-(1,1,2,2,2-pentafluoroethyl)phenoxy]benzoate.
What is the SMILES notation for methyl 4-[4-(1,1,2,2,2-pentafluoroethyl)phenoxy]benzoate?
The canonical SMILES for methyl 4-[4-(1,1,2,2,2-pentafluoroethyl)phenoxy]benzoate is COC(=O)c1ccc(Oc2ccc(C(F)(F)C(F)(F)F)cc2)cc1.
What is the InChIKey of methyl 4-[4-(1,1,2,2,2-pentafluoroethyl)phenoxy]benzoate?
The InChIKey is MNDMTLIFMRXVRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11F5O3/c1-23-14(22)10-2-6-12(7-3-10)24-13-8-4-11(5-9-13)15(17,18)16(19,20)21/h2-9H,1H3.
What are the key properties of methyl 4-[4-(1,1,2,2,2-pentafluoroethyl)phenoxy]benzoate?
methyl 4-[4-(1,1,2,2,2-pentafluoroethyl)phenoxy]benzoate has a molecular weight of 346.25 g/mol, XLogP of 4.92, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[4-(1,1,2,2,2-pentafluoroethyl)phenoxy]benzoate is sourced from PubChem (CID 142415405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).