C16H11F5O3 — CID 142415405
methyl 4-[4-(1,1,2,2,2-pentafluoroethyl)phenoxy]benzoate (PubChem CID 142415405) has the molecular formula C16H11F5O3 and a molecular weight of 346.25 g/mol. Its IUPAC name is methyl 4-[4-(1,1,2,2,2-pentafluoroethyl)phenoxy]benzoate.
| Compound Name | methyl 4-[4-(1,1,2,2,2-pentafluoroethyl)phenoxy]benzoate |
|---|---|
| PubChem CID | 142415405 |
| Molecular Formula | C16H11F5O3 |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | methyl 4-[4-(1,1,2,2,2-pentafluoroethyl)phenoxy]benzoate |
| SMILES | COC(=O)c1ccc(Oc2ccc(C(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H11F5O3/c1-23-14(22)10-2-6-12(7-3-10)24-13-8-4-11(5-9-13)15(17,18)16(19,20)21/h2-9H,1H3 |
| InChIKey | MNDMTLIFMRXVRJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|