C13H16F2O4 — CID 143517115
ethane;methyl 4-(1,1-difluoro-2-methoxy-2-oxoethyl)benzoate (PubChem CID 143517115) has the molecular formula C13H16F2O4 and a molecular weight of 274.26 g/mol. Its IUPAC name is ethane;methyl 4-(1,1-difluoro-2-methoxy-2-oxoethyl)benzoate.
| Compound Name | ethane;methyl 4-(1,1-difluoro-2-methoxy-2-oxoethyl)benzoate |
|---|---|
| PubChem CID | 143517115 |
| Molecular Formula | C13H16F2O4 |
| Molecular Weight | 274.26 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | ethane;methyl 4-(1,1-difluoro-2-methoxy-2-oxoethyl)benzoate |
| SMILES | CC.COC(=O)c1ccc(C(F)(F)C(=O)OC)cc1 |
| InChI | InChI=1S/C11H10F2O4.C2H6/c1-16-9(14)7-3-5-8(6-4-7)11(12,13)10(15)17-2;1-2/h3-6H,1-2H3;1-2H3 |
| InChIKey | SMVXNGBGDQUYBW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.26 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |