C9H7F2IO2 — CID 71045669
methyl 2,2-difluoro-2-(4-iodophenyl)acetate (PubChem CID 71045669) has the molecular formula C9H7F2IO2 and a molecular weight of 312.05 g/mol. Its IUPAC name is methyl 2,2-difluoro-2-(4-iodophenyl)acetate.
| Compound Name | methyl 2,2-difluoro-2-(4-iodophenyl)acetate |
|---|---|
| PubChem CID | 71045669 |
| Molecular Formula | C9H7F2IO2 |
| Molecular Weight | 312.05 g/mol |
| Exact Mass | 311.95 |
| IUPAC Name | methyl 2,2-difluoro-2-(4-iodophenyl)acetate |
| SMILES | COC(=O)C(F)(F)c1ccc(I)cc1 |
| InChI | InChI=1S/C9H7F2IO2/c1-14-8(13)9(10,11)6-2-4-7(12)5-3-6/h2-5H,1H3 |
| InChIKey | SDBDFJKEPDKPTG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.05 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|