C11H9F4IO3 — CID 73427483
methyl 2,3,3,3-tetrafluoro-2-(5-iodo-2-methoxyphenyl)propanoate (PubChem CID 73427483) has the molecular formula C11H9F4IO3 and a molecular weight of 392.09 g/mol. Its IUPAC name is methyl 2,3,3,3-tetrafluoro-2-(5-iodo-2-methoxyphenyl)propanoate.
| Compound Name | methyl 2,3,3,3-tetrafluoro-2-(5-iodo-2-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 73427483 |
| Molecular Formula | C11H9F4IO3 |
| Molecular Weight | 392.09 g/mol |
| Exact Mass | 391.95 |
| IUPAC Name | methyl 2,3,3,3-tetrafluoro-2-(5-iodo-2-methoxyphenyl)propanoate |
| SMILES | COC(=O)C(F)(c1cc(I)ccc1OC)C(F)(F)F |
| InChI | InChI=1S/C11H9F4IO3/c1-18-8-4-3-6(16)5-7(8)10(12,9(17)19-2)11(13,14)15/h3-5H,1-2H3 |
| InChIKey | UKGXGZLPQXSNFJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.09 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|