C14H17F3INO3 — CID 141062161
2-hydroxy-4-(4-iodo-2-methoxyphenyl)-4-methyl-2-(trifluoromethyl)pentanamide (PubChem CID 141062161) has the molecular formula C14H17F3INO3 and a molecular weight of 431.19 g/mol. Its IUPAC name is 2-hydroxy-4-(4-iodo-2-methoxyphenyl)-4-methyl-2-(trifluoromethyl)pentanamide.
| Compound Name | 2-hydroxy-4-(4-iodo-2-methoxyphenyl)-4-methyl-2-(trifluoromethyl)pentanamide |
|---|---|
| PubChem CID | 141062161 |
| Molecular Formula | C14H17F3INO3 |
| Molecular Weight | 431.19 g/mol |
| Exact Mass | 431.02 |
| IUPAC Name | 2-hydroxy-4-(4-iodo-2-methoxyphenyl)-4-methyl-2-(trifluoromethyl)pentanamide |
| SMILES | COc1cc(I)ccc1C(C)(C)CC(O)(C(N)=O)C(F)(F)F |
| InChI | InChI=1S/C14H17F3INO3/c1-12(2,7-13(21,11(19)20)14(15,16)17)9-5-4-8(18)6-10(9)22-3/h4-6,21H,7H2,1-3H3,(H2,19,20) |
| InChIKey | AEHSARVHRZSLQA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.19 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|