C15H17F3N2O3 — CID 141062160
4-(4-cyano-2-methoxyphenyl)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentanamide (PubChem CID 141062160) has the molecular formula C15H17F3N2O3 and a molecular weight of 330.31 g/mol. Its IUPAC name is 4-(4-cyano-2-methoxyphenyl)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentanamide.
| Compound Name | 4-(4-cyano-2-methoxyphenyl)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentanamide |
|---|---|
| PubChem CID | 141062160 |
| Molecular Formula | C15H17F3N2O3 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 4-(4-cyano-2-methoxyphenyl)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentanamide |
| SMILES | COc1cc(C#N)ccc1C(C)(C)CC(O)(C(N)=O)C(F)(F)F |
| InChI | InChI=1S/C15H17F3N2O3/c1-13(2,8-14(22,12(20)21)15(16,17)18)10-5-4-9(7-19)6-11(10)23-3/h4-6,22H,8H2,1-3H3,(H2,20,21) |
| InChIKey | IOYCTIDLANRFPP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |