C16H20F4O4 — CID 23584372
methyl (3R)-5-(5-fluoro-2-methoxyphenyl)-3-hydroxy-5-methyl-3-(trifluoromethyl)hexanoate (PubChem CID 23584372) has the molecular formula C16H20F4O4 and a molecular weight of 352.32 g/mol. Its IUPAC name is methyl (3R)-5-(5-fluoro-2-methoxyphenyl)-3-hydroxy-5-methyl-3-(trifluoromethyl)hexanoate.
| Compound Name | methyl (3R)-5-(5-fluoro-2-methoxyphenyl)-3-hydroxy-5-methyl-3-(trifluoromethyl)hexanoate |
|---|---|
| PubChem CID | 23584372 |
| Molecular Formula | C16H20F4O4 |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | methyl (3R)-5-(5-fluoro-2-methoxyphenyl)-3-hydroxy-5-methyl-3-(trifluoromethyl)hexanoate |
| SMILES | COC(=O)C[C@](O)(CC(C)(C)c1cc(F)ccc1OC)C(F)(F)F |
| InChI | InChI=1S/C16H20F4O4/c1-14(2,11-7-10(17)5-6-12(11)23-3)9-15(22,16(18,19)20)8-13(21)24-4/h5-7,22H,8-9H2,1-4H3/t15-/m0/s1 |
| InChIKey | UERHWFQGNXTGDP-HNNXBMFYSA-N |
| XLogP | 3.36 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |