C19H20F5NO2 — CID 10309505
1,1,1-trifluoro-4-(5-fluoro-2-methoxyphenyl)-2-[(6-fluoro-2-pyridinyl)methyl]-4-methylpentan-2-ol (PubChem CID 10309505) has the molecular formula C19H20F5NO2 and a molecular weight of 389.36 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-(5-fluoro-2-methoxyphenyl)-2-[(6-fluoro-2-pyridinyl)methyl]-4-methylpentan-2-ol.
| Compound Name | 1,1,1-trifluoro-4-(5-fluoro-2-methoxyphenyl)-2-[(6-fluoro-2-pyridinyl)methyl]-4-methylpentan-2-ol |
|---|---|
| PubChem CID | 10309505 |
| Molecular Formula | C19H20F5NO2 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 1,1,1-trifluoro-4-(5-fluoro-2-methoxyphenyl)-2-[(6-fluoro-2-pyridinyl)methyl]-4-methylpentan-2-ol |
| SMILES | COc1ccc(F)cc1C(C)(C)CC(O)(Cc1cccc(F)n1)C(F)(F)F |
| InChI | InChI=1S/C19H20F5NO2/c1-17(2,14-9-12(20)7-8-15(14)27-3)11-18(26,19(22,23)24)10-13-5-4-6-16(21)25-13/h4-9,26H,10-11H2,1-3H3 |
| InChIKey | MTTXGENGENMNBQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|