C20H19F7O2 — CID 10151117
1,1,1-trifluoro-4-(5-fluoro-2-methoxyphenyl)-4-methyl-2-[(2,3,5-trifluorophenyl)methyl]pentan-2-ol (PubChem CID 10151117) has the molecular formula C20H19F7O2 and a molecular weight of 424.36 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-(5-fluoro-2-methoxyphenyl)-4-methyl-2-[(2,3,5-trifluorophenyl)methyl]pentan-2-ol.
| Compound Name | 1,1,1-trifluoro-4-(5-fluoro-2-methoxyphenyl)-4-methyl-2-[(2,3,5-trifluorophenyl)methyl]pentan-2-ol |
|---|---|
| PubChem CID | 10151117 |
| Molecular Formula | C20H19F7O2 |
| Molecular Weight | 424.36 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 1,1,1-trifluoro-4-(5-fluoro-2-methoxyphenyl)-4-methyl-2-[(2,3,5-trifluorophenyl)methyl]pentan-2-ol |
| SMILES | COc1ccc(F)cc1C(C)(C)CC(O)(Cc1cc(F)cc(F)c1F)C(F)(F)F |
| InChI | InChI=1S/C20H19F7O2/c1-18(2,14-7-12(21)4-5-16(14)29-3)10-19(28,20(25,26)27)9-11-6-13(22)8-15(23)17(11)24/h4-8,28H,9-10H2,1-3H3 |
| InChIKey | JISLEEIOHVEOKP-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.36 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|