C21H23F4NO3 — CID 58959937
3-[4-(5-fluoro-2-methoxyphenyl)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentyl]benzamide (PubChem CID 58959937) has the molecular formula C21H23F4NO3 and a molecular weight of 413.41 g/mol. Its IUPAC name is 3-[4-(5-fluoro-2-methoxyphenyl)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentyl]benzamide.
| Compound Name | 3-[4-(5-fluoro-2-methoxyphenyl)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentyl]benzamide |
|---|---|
| PubChem CID | 58959937 |
| Molecular Formula | C21H23F4NO3 |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 3-[4-(5-fluoro-2-methoxyphenyl)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentyl]benzamide |
| SMILES | COc1ccc(F)cc1C(C)(C)CC(O)(Cc1cccc(C(N)=O)c1)C(F)(F)F |
| InChI | InChI=1S/C21H23F4NO3/c1-19(2,16-10-15(22)7-8-17(16)29-3)12-20(28,21(23,24)25)11-13-5-4-6-14(9-13)18(26)27/h4-10,28H,11-12H2,1-3H3,(H2,26,27) |
| InChIKey | YXJNHCGPVJUEOM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |