C12H15IO3 — CID 79830010
3-(5-iodo-2-methoxyphenyl)-3-methylbutanoic acid (PubChem CID 79830010) has the molecular formula C12H15IO3 and a molecular weight of 334.15 g/mol. Its IUPAC name is 3-(5-iodo-2-methoxyphenyl)-3-methylbutanoic acid.
| Compound Name | 3-(5-iodo-2-methoxyphenyl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 79830010 |
| Molecular Formula | C12H15IO3 |
| Molecular Weight | 334.15 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 3-(5-iodo-2-methoxyphenyl)-3-methylbutanoic acid |
| SMILES | COc1ccc(I)cc1C(C)(C)CC(=O)O |
| InChI | InChI=1S/C12H15IO3/c1-12(2,7-11(14)15)9-6-8(13)4-5-10(9)16-3/h4-6H,7H2,1-3H3,(H,14,15) |
| InChIKey | XSKDIUPWPLEXPL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.15 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|