C14H19FO3 — CID 117389154
3-[5-(1-fluoroethyl)-2-methoxyphenyl]-3-methylbutanoic acid (PubChem CID 117389154) has the molecular formula C14H19FO3 and a molecular weight of 254.30 g/mol. Its IUPAC name is 3-[5-(1-fluoroethyl)-2-methoxyphenyl]-3-methylbutanoic acid.
| Compound Name | 3-[5-(1-fluoroethyl)-2-methoxyphenyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 117389154 |
| Molecular Formula | C14H19FO3 |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 3-[5-(1-fluoroethyl)-2-methoxyphenyl]-3-methylbutanoic acid |
| SMILES | COc1ccc(C(C)F)cc1C(C)(C)CC(=O)O |
| InChI | InChI=1S/C14H19FO3/c1-9(15)10-5-6-12(18-4)11(7-10)14(2,3)8-13(16)17/h5-7,9H,8H2,1-4H3,(H,16,17) |
| InChIKey | BBFVKGWYUBTUBW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |