C15H22O3S — CID 117453988
3-(4-ethyl-2-methoxy-5-methylsulfanylphenyl)-3-methylbutanoic acid (PubChem CID 117453988) has the molecular formula C15H22O3S and a molecular weight of 282.40 g/mol. Its IUPAC name is 3-(4-ethyl-2-methoxy-5-methylsulfanylphenyl)-3-methylbutanoic acid.
| Compound Name | 3-(4-ethyl-2-methoxy-5-methylsulfanylphenyl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 117453988 |
| Molecular Formula | C15H22O3S |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 3-(4-ethyl-2-methoxy-5-methylsulfanylphenyl)-3-methylbutanoic acid |
| SMILES | CCc1cc(OC)c(C(C)(C)CC(=O)O)cc1SC |
| InChI | InChI=1S/C15H22O3S/c1-6-10-7-12(18-4)11(8-13(10)19-5)15(2,3)9-14(16)17/h7-8H,6,9H2,1-5H3,(H,16,17) |
| InChIKey | SHLYGULUYMFTNP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |