C22H26F3NO2 — CID 142814251
(Z)-2-amino-6-(2-methoxyphenyl)-6-methyl-1-phenyl-4-(trifluoromethyl)hept-1-en-4-ol (PubChem CID 142814251) has the molecular formula C22H26F3NO2 and a molecular weight of 393.45 g/mol. Its IUPAC name is (Z)-2-amino-6-(2-methoxyphenyl)-6-methyl-1-phenyl-4-(trifluoromethyl)hept-1-en-4-ol.
| Compound Name | (Z)-2-amino-6-(2-methoxyphenyl)-6-methyl-1-phenyl-4-(trifluoromethyl)hept-1-en-4-ol |
|---|---|
| PubChem CID | 142814251 |
| Molecular Formula | C22H26F3NO2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | (Z)-2-amino-6-(2-methoxyphenyl)-6-methyl-1-phenyl-4-(trifluoromethyl)hept-1-en-4-ol |
| SMILES | COc1ccccc1C(C)(C)CC(O)(C/C(N)=C/c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C22H26F3NO2/c1-20(2,18-11-7-8-12-19(18)28-3)15-21(27,22(23,24)25)14-17(26)13-16-9-5-4-6-10-16/h4-13,27H,14-15,26H2,1-3H3/b17-13- |
| InChIKey | VKFJGVIPMJBELB-LGMDPLHJSA-N |
| XLogP | 5.05 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |